C13H18N2O — CID 115104952
N-methyl-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)propanamide (PubChem CID 115104952) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-methyl-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)propanamide.
| Compound Name | N-methyl-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)propanamide |
|---|---|
| PubChem CID | 115104952 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-methyl-3-(1,2,3,4-tetrahydroisoquinolin-8-yl)propanamide |
| SMILES | CNC(=O)CCc1cccc2c1CNCC2 |
| InChI | InChI=1S/C13H18N2O/c1-14-13(16)6-5-10-3-2-4-11-7-8-15-9-12(10)11/h2-4,15H,5-9H2,1H3,(H,14,16) |
| InChIKey | XQDVXPKCRBFYLA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |