About methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate
methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate (PubChem CID 11510521) has the molecular formula C25H22N4O4
and a molecular weight of 442.48 g/mol. Its IUPAC name is methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate |
| PubChem CID | 11510521 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccc(C3(O)c4ccccc4C(=O)N3c3cc(C)cc(C)c3)cc2[nH]1 |
| InChI | InChI=1S/C25H22N4O4/c1-14-10-15(2)12-17(11-14)29-22(30)18-6-4-5-7-19(18)25(29,32)16-8-9-20-21(13-16)27-23(26-20)28-24(31)33-3/h4-13,32H,1-3H3,(H2,26,27,28,31) |
| InChIKey | MXPXZVZGDXXHMY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate?
The IUPAC name of methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate (CID 11510521) is methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate.
What is the SMILES notation for methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate?
The canonical SMILES for methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate is COC(=O)Nc1nc2ccc(C3(O)c4ccccc4C(=O)N3c3cc(C)cc(C)c3)cc2[nH]1.
What is the InChIKey of methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate?
The InChIKey is MXPXZVZGDXXHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N4O4/c1-14-10-15(2)12-17(11-14)29-22(30)18-6-4-5-7-19(18)25(29,32)16-8-9-20-21(13-16)27-23(26-20)28-24(31)33-3/h4-13,32H,1-3H3,(H2,26,27,28,31).
What are the key properties of methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate?
methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate has a molecular weight of 442.48 g/mol, XLogP of 4.21, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[6-[2-(3,5-dimethylphenyl)-1-hydroxy-3-oxoisoindol-1-yl]-1H-benzimidazol-2-yl]carbamate is sourced from PubChem (CID 11510521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).