About N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide
N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide (PubChem CID 11510560) has the molecular formula C24H20N4O5
and a molecular weight of 444.45 g/mol. Its IUPAC name is N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide.
Molecular Properties
| Compound Name | N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide |
| PubChem CID | 11510560 |
| Molecular Formula | C24H20N4O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)NC(=O)c4ccccc4)nc3)c2cc1OC |
| InChI | InChI=1S/C24H20N4O5/c1-31-20-12-17-18(13-21(20)32-2)25-11-10-19(17)33-16-8-9-22(26-14-16)27-24(30)28-23(29)15-6-4-3-5-7-15/h3-14H,1-2H3,(H2,26,27,28,29,30) |
| InChIKey | SNBQVLOBDRCPCE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide?
The IUPAC name of N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide (CID 11510560) is N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide.
What is the SMILES notation for N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide?
The canonical SMILES for N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide is COc1cc2nccc(Oc3ccc(NC(=O)NC(=O)c4ccccc4)nc3)c2cc1OC.
What is the InChIKey of N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide?
The InChIKey is SNBQVLOBDRCPCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N4O5/c1-31-20-12-17-18(13-21(20)32-2)25-11-10-19(17)33-16-8-9-22(26-14-16)27-24(30)28-23(29)15-6-4-3-5-7-15/h3-14H,1-2H3,(H2,26,27,28,29,30).
What are the key properties of N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide?
N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide has a molecular weight of 444.45 g/mol, XLogP of 4.40, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]carbamoyl]benzamide is sourced from PubChem (CID 11510560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).