C24H24N5O4+ — CID 11510582
[(3R)-1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]pyrrolidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate (PubChem CID 11510582) has the molecular formula C24H24N5O4+ and a molecular weight of 446.49 g/mol. Its IUPAC name is [(3R)-1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]pyrrolidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate.
| Compound Name | [(3R)-1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]pyrrolidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate |
|---|---|
| PubChem CID | 11510582 |
| Molecular Formula | C24H24N5O4+ |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [(3R)-1-methyl-1-[2-oxo-2-(1,3,5-triazin-2-ylamino)ethyl]pyrrolidin-1-ium-3-yl] 9-hydroxyfluorene-9-carboxylate |
| SMILES | C[N+]1(CC(=O)Nc2ncncn2)CC[C@@H](OC(=O)C2(O)c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C24H23N5O4/c1-29(13-21(30)28-23-26-14-25-15-27-23)11-10-16(12-29)33-22(31)24(32)19-8-4-2-6-17(19)18-7-3-5-9-20(18)24/h2-9,14-16,32H,10-13H2,1H3/p+1/t16-,29?/m1/s1 |
| InChIKey | SZTSCLGUPZNMDB-VSMAWVSWSA-O |
| XLogP | 1.49 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|