C18H23NO3 — CID 115106617
2-methyl-3-[1-(oxan-4-ylmethyl)indol-7-yl]propanoic acid (PubChem CID 115106617) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-methyl-3-[1-(oxan-4-ylmethyl)indol-7-yl]propanoic acid.
| Compound Name | 2-methyl-3-[1-(oxan-4-ylmethyl)indol-7-yl]propanoic acid |
|---|---|
| PubChem CID | 115106617 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-methyl-3-[1-(oxan-4-ylmethyl)indol-7-yl]propanoic acid |
| SMILES | CC(Cc1cccc2ccn(CC3CCOCC3)c12)C(=O)O |
| InChI | InChI=1S/C18H23NO3/c1-13(18(20)21)11-16-4-2-3-15-5-8-19(17(15)16)12-14-6-9-22-10-7-14/h2-5,8,13-14H,6-7,9-12H2,1H3,(H,20,21) |
| InChIKey | LEFKLKBPPQNSNU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |