C15H9F2NO9S2 — CID 11510673
[2-(2,3-difluoro-4-sulfooxyphenyl)-7-ethenyl-1,3-benzoxazol-5-yl] hydrogen sulfate (PubChem CID 11510673) has the molecular formula C15H9F2NO9S2 and a molecular weight of 449.37 g/mol. Its IUPAC name is [2-(2,3-difluoro-4-sulfooxyphenyl)-7-ethenyl-1,3-benzoxazol-5-yl] hydrogen sulfate.
| Compound Name | [2-(2,3-difluoro-4-sulfooxyphenyl)-7-ethenyl-1,3-benzoxazol-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 11510673 |
| Molecular Formula | C15H9F2NO9S2 |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | [2-(2,3-difluoro-4-sulfooxyphenyl)-7-ethenyl-1,3-benzoxazol-5-yl] hydrogen sulfate |
| SMILES | C=Cc1cc(OS(=O)(=O)O)cc2nc(-c3ccc(OS(=O)(=O)O)c(F)c3F)oc12 |
| InChI | InChI=1S/C15H9F2NO9S2/c1-2-7-5-8(26-28(19,20)21)6-10-14(7)25-15(18-10)9-3-4-11(13(17)12(9)16)27-29(22,23)24/h2-6H,1H2,(H,19,20,21)(H,22,23,24) |
| InChIKey | DHWRFEGUKUYQAW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|