C17H24F6N2O5 — CID 11510695
3-methylpentan-3-yl (3S)-3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate (PubChem CID 11510695) has the molecular formula C17H24F6N2O5 and a molecular weight of 450.38 g/mol. Its IUPAC name is 3-methylpentan-3-yl (3S)-3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate.
| Compound Name | 3-methylpentan-3-yl (3S)-3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 11510695 |
| Molecular Formula | C17H24F6N2O5 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 3-methylpentan-3-yl (3S)-3-[[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazole-3-carbonyl]amino]butanoate |
| SMILES | CCC(C)(CC)OC(=O)C[C@H](C)NC(=O)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H24F6N2O5/c1-5-14(4,6-2)29-12(26)7-9(3)24-13(27)10-8-11(30-25-10)15(28,16(18,19)20)17(21,22)23/h9,11,28H,5-8H2,1-4H3,(H,24,27)/t9-,11?/m0/s1 |
| InChIKey | BMCZMRJCAQTCOR-FTNKSUMCSA-N |
| XLogP | 3.00 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |