About 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one
6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one (PubChem CID 115107424) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one |
| PubChem CID | 115107424 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one |
| SMILES | O=C1CNCc2cc3cccc(O)c3n21 |
| InChI | InChI=1S/C11H10N2O2/c14-9-3-1-2-7-4-8-5-12-6-10(15)13(8)11(7)9/h1-4,12,14H,5-6H2 |
| InChIKey | BNRVJQIYGUWLRP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one?
The IUPAC name of 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one (CID 115107424) is 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one.
What is the SMILES notation for 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one?
The canonical SMILES for 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one is O=C1CNCc2cc3cccc(O)c3n21.
What is the InChIKey of 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one?
The InChIKey is BNRVJQIYGUWLRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c14-9-3-1-2-7-4-8-5-12-6-10(15)13(8)11(7)9/h1-4,12,14H,5-6H2.
What are the key properties of 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one?
6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one has a molecular weight of 202.21 g/mol, XLogP of 1.09, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,3-dihydro-1H-pyrazino[1,2-a]indol-4-one is sourced from PubChem (CID 115107424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).