C11H12N2O — CID 115107523
2,4,10,10a-tetrahydro-1H-pyrazino[1,2-a]indol-3-one (PubChem CID 115107523) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 2,4,10,10a-tetrahydro-1H-pyrazino[1,2-a]indol-3-one.
| Compound Name | 2,4,10,10a-tetrahydro-1H-pyrazino[1,2-a]indol-3-one |
|---|---|
| PubChem CID | 115107523 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2,4,10,10a-tetrahydro-1H-pyrazino[1,2-a]indol-3-one |
| SMILES | O=C1CN2c3ccccc3CC2CN1 |
| InChI | InChI=1S/C11H12N2O/c14-11-7-13-9(6-12-11)5-8-3-1-2-4-10(8)13/h1-4,9H,5-7H2,(H,12,14) |
| InChIKey | NKGUXPKMRGVYCH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |