C25H31N3O3S — CID 11510760
N-cyclooctyl-4,11-dimethyl-9-oxo-10-(thiophen-2-ylmethyl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide (PubChem CID 11510760) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-cyclooctyl-4,11-dimethyl-9-oxo-10-(thiophen-2-ylmethyl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide.
| Compound Name | N-cyclooctyl-4,11-dimethyl-9-oxo-10-(thiophen-2-ylmethyl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
|---|---|
| PubChem CID | 11510760 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-cyclooctyl-4,11-dimethyl-9-oxo-10-(thiophen-2-ylmethyl)-5-oxa-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),3,7-triene-11-carboxamide |
| SMILES | Cc1cc2c(cc3n2CC(C)(C(=O)NC2CCCCCCC2)N(Cc2cccs2)C3=O)o1 |
| InChI | InChI=1S/C25H31N3O3S/c1-17-13-20-22(31-17)14-21-23(29)28(15-19-11-8-12-32-19)25(2,16-27(20)21)24(30)26-18-9-6-4-3-5-7-10-18/h8,11-14,18H,3-7,9-10,15-16H2,1-2H3,(H,26,30) |
| InChIKey | CMMYLDMZZLQHPC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |