C26H20N2O6 — CID 11510826
2,6-bis[(2-methoxyphenyl)methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 11510826) has the molecular formula C26H20N2O6 and a molecular weight of 456.45 g/mol. Its IUPAC name is 2,6-bis[(2-methoxyphenyl)methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[(2-methoxyphenyl)methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 11510826 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2,6-bis[(2-methoxyphenyl)methyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | COc1ccccc1Cn1c(=O)c2cc3c(=O)n(Cc4ccccc4OC)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C26H20N2O6/c1-33-21-9-5-3-7-15(21)13-27-23(29)17-11-19-20(12-18(17)24(27)30)26(32)28(25(19)31)14-16-8-4-6-10-22(16)34-2/h3-12H,13-14H2,1-2H3 |
| InChIKey | HNNFMWKTTYJZCL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |