C28H37N3O3 — CID 11510981
3-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-3-(2-methylpropyl)-1H-indol-2-one (PubChem CID 11510981) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is 3-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-3-(2-methylpropyl)-1H-indol-2-one.
| Compound Name | 3-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-3-(2-methylpropyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 11510981 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | 3-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]-3-(2-methylpropyl)-1H-indol-2-one |
| SMILES | CC(C)CC1(CCCCN2CCN(c3ccc4c(c3)OCCO4)CC2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C28H37N3O3/c1-21(2)20-28(23-7-3-4-8-24(23)29-27(28)32)11-5-6-12-30-13-15-31(16-14-30)22-9-10-25-26(19-22)34-18-17-33-25/h3-4,7-10,19,21H,5-6,11-18,20H2,1-2H3,(H,29,32) |
| InChIKey | VHVITLIWKWDBEX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|