C24H31Cl2N3O2 — CID 11510991
(2E,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)penta-2,4-dienamide (PubChem CID 11510991) has the molecular formula C24H31Cl2N3O2 and a molecular weight of 464.44 g/mol. Its IUPAC name is (2E,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 11510991 |
| Molecular Formula | C24H31Cl2N3O2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2E,4E)-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)penta-2,4-dienamide |
| SMILES | CO/C(=C/C=C/c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C24H31Cl2N3O2/c1-23(2)13-17(14-24(3,4)29(23)5)28-22(30)21(31-6)9-7-8-16-10-15-11-18(25)19(26)12-20(15)27-16/h7-12,17,27H,13-14H2,1-6H3,(H,28,30)/b8-7+,21-9+ |
| InChIKey | NAQKKRDQKSXZSM-JTWVDUCRSA-N |
| XLogP | 5.79 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|