C25H33N5O2S — CID 11511082
N-[2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 11511082) has the molecular formula C25H33N5O2S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 11511082 |
| Molecular Formula | C25H33N5O2S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[2-[4-(1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCN1CC=C(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C25H33N5O2S/c31-23(8-4-3-7-22-24-21(16-33-22)28-25(32)29-24)26-11-14-30-12-9-17(10-13-30)19-15-27-20-6-2-1-5-18(19)20/h1-2,5-6,9,15,21-22,24,27H,3-4,7-8,10-14,16H2,(H,26,31)(H2,28,29,32) |
| InChIKey | MVDIHPTYPOOXGQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|