About 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline
5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline (PubChem CID 115111096) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline.
Molecular Properties
| Compound Name | 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline |
| PubChem CID | 115111096 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline |
| SMILES | Cc1ccc(/C=C/CN)cc1N(C)C |
| InChI | InChI=1S/C12H18N2/c1-10-6-7-11(5-4-8-13)9-12(10)14(2)3/h4-7,9H,8,13H2,1-3H3/b5-4+ |
| InChIKey | DMQMBZOXBVAYHA-SNAWJCMRSA-N |
| XLogP | 2.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline?
The IUPAC name of 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline (CID 115111096) is 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline.
What is the SMILES notation for 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline?
The canonical SMILES for 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline is Cc1ccc(/C=C/CN)cc1N(C)C.
What is the InChIKey of 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline?
The InChIKey is DMQMBZOXBVAYHA-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H18N2/c1-10-6-7-11(5-4-8-13)9-12(10)14(2)3/h4-7,9H,8,13H2,1-3H3/b5-4+.
What are the key properties of 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline?
5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline has a molecular weight of 190.29 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-3-aminoprop-1-enyl]-N,N,2-trimethylaniline is sourced from PubChem (CID 115111096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).