C28H38O6 — CID 11511137
(2E,4Z,6R,8Z,10E,14E,17S,18E,20Z)-6-methoxy-2,5,17-trimethyl-20-(2-oxoethyl)docosa-2,4,8,10,14,18,20-heptaenedioic acid (PubChem CID 11511137) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is (2E,4Z,6R,8Z,10E,14E,17S,18E,20Z)-6-methoxy-2,5,17-trimethyl-20-(2-oxoethyl)docosa-2,4,8,10,14,18,20-heptaenedioic acid.
| Compound Name | (2E,4Z,6R,8Z,10E,14E,17S,18E,20Z)-6-methoxy-2,5,17-trimethyl-20-(2-oxoethyl)docosa-2,4,8,10,14,18,20-heptaenedioic acid |
|---|---|
| PubChem CID | 11511137 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | (2E,4Z,6R,8Z,10E,14E,17S,18E,20Z)-6-methoxy-2,5,17-trimethyl-20-(2-oxoethyl)docosa-2,4,8,10,14,18,20-heptaenedioic acid |
| SMILES | CO[C@H](C/C=C\C=C\CC/C=C/C[C@H](C)/C=C/C(=C\C(=O)O)CC=O)/C(C)=C\C=C(/C)C(=O)O |
| InChI | InChI=1S/C28H38O6/c1-22(15-18-25(19-20-29)21-27(30)31)13-11-9-7-5-6-8-10-12-14-26(34-4)23(2)16-17-24(3)28(32)33/h6,8-12,15-18,20-22,26H,5,7,13-14,19H2,1-4H3,(H,30,31)(H,32,33)/b8-6+,11-9+,12-10-,18-15+,23-16-,24-17+,25-21+/t22-,26+/m0/s1 |
| InChIKey | WKKDQQYMTBNSIG-XZGYVVSRSA-N |
| XLogP | 6.00 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|