About 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine
5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine (PubChem CID 115111588) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine |
| PubChem CID | 115111588 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine |
| SMILES | COc1c(C)c(C)cc(C)c1-c1cc(N)n[nH]1 |
| InChI | InChI=1S/C13H17N3O/c1-7-5-8(2)12(13(17-4)9(7)3)10-6-11(14)16-15-10/h5-6H,1-4H3,(H3,14,15,16) |
| InChIKey | OOUPAMBIBWTWSF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine?
The IUPAC name of 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine (CID 115111588) is 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine.
What is the SMILES notation for 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine?
The canonical SMILES for 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine is COc1c(C)c(C)cc(C)c1-c1cc(N)n[nH]1.
What is the InChIKey of 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine?
The InChIKey is OOUPAMBIBWTWSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c1-7-5-8(2)12(13(17-4)9(7)3)10-6-11(14)16-15-10/h5-6H,1-4H3,(H3,14,15,16).
What are the key properties of 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine?
5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine has a molecular weight of 231.30 g/mol, XLogP of 2.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxy-3,4,6-trimethylphenyl)-1H-pyrazol-3-amine is sourced from PubChem (CID 115111588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).