C26H36N2O4S — CID 11511194
2-[[2-[5-(diethylamino)pentyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 11511194) has the molecular formula C26H36N2O4S and a molecular weight of 472.65 g/mol. Its IUPAC name is 2-[[2-[5-(diethylamino)pentyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
| Compound Name | 2-[[2-[5-(diethylamino)pentyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 11511194 |
| Molecular Formula | C26H36N2O4S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-[[2-[5-(diethylamino)pentyl]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| SMILES | CCN(CC)CCCCCc1ccccc1S(=O)(=O)Nc1ccc2c(c1C(=O)O)CCCC2 |
| InChI | InChI=1S/C26H36N2O4S/c1-3-28(4-2)19-11-5-6-13-21-14-8-10-16-24(21)33(31,32)27-23-18-17-20-12-7-9-15-22(20)25(23)26(29)30/h8,10,14,16-18,27H,3-7,9,11-13,15,19H2,1-2H3,(H,29,30) |
| InChIKey | DPRJLBFCINVSSP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|