C19H21Br2N2+ — CID 11511196
1,3-bis(4-bromo-2,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium (PubChem CID 11511196) has the molecular formula C19H21Br2N2+ and a molecular weight of 437.20 g/mol. Its IUPAC name is 1,3-bis(4-bromo-2,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,3-bis(4-bromo-2,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 11511196 |
| Molecular Formula | C19H21Br2N2+ |
| Molecular Weight | 437.20 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 1,3-bis(4-bromo-2,6-dimethylphenyl)-4,5-dihydroimidazol-1-ium |
| SMILES | Cc1cc(Br)cc(C)c1N1C=[N+](c2c(C)cc(Br)cc2C)CC1 |
| InChI | InChI=1S/C19H21Br2N2/c1-12-7-16(20)8-13(2)18(12)22-5-6-23(11-22)19-14(3)9-17(21)10-15(19)4/h7-11H,5-6H2,1-4H3/q+1 |
| InChIKey | DSCMOHOUNGQXTG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.20 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|