C21H22F3N5O2S — CID 1151121
2-[[4-ethyl-5-[(4-methoxyanilino)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 1151121) has the molecular formula C21H22F3N5O2S and a molecular weight of 465.50 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[(4-methoxyanilino)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[[4-ethyl-5-[(4-methoxyanilino)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1151121 |
| Molecular Formula | C21H22F3N5O2S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-[[4-ethyl-5-[(4-methoxyanilino)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCn1c(CNc2ccc(OC)cc2)nnc1SCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H22F3N5O2S/c1-3-29-18(12-25-14-8-10-15(31-2)11-9-14)27-28-20(29)32-13-19(30)26-17-7-5-4-6-16(17)21(22,23)24/h4-11,25H,3,12-13H2,1-2H3,(H,26,30) |
| InChIKey | QMPZUQFAXLQZMH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|