About 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol
3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol (PubChem CID 115112143) has the molecular formula C9H6F3N3O
and a molecular weight of 229.16 g/mol. Its IUPAC name is 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol.
Molecular Properties
| Compound Name | 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol |
| PubChem CID | 115112143 |
| Molecular Formula | C9H6F3N3O |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol |
| SMILES | Nc1[nH]ncc1-c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C9H6F3N3O/c10-5-1-3(4-2-14-15-9(4)13)6(11)8(16)7(5)12/h1-2,16H,(H3,13,14,15) |
| InChIKey | OSZVMQWLTGGWHO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol?
The IUPAC name of 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol (CID 115112143) is 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol.
What is the SMILES notation for 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol?
The canonical SMILES for 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol is Nc1[nH]ncc1-c1cc(F)c(F)c(O)c1F.
What is the InChIKey of 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol?
The InChIKey is OSZVMQWLTGGWHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F3N3O/c10-5-1-3(4-2-14-15-9(4)13)6(11)8(16)7(5)12/h1-2,16H,(H3,13,14,15).
What are the key properties of 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol?
3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol has a molecular weight of 229.16 g/mol, XLogP of 1.78, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-amino-1H-pyrazol-4-yl)-2,5,6-trifluorophenol is sourced from PubChem (CID 115112143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).