About 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine
4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 115112274) has the molecular formula C10H7F3N2O2
and a molecular weight of 244.17 g/mol. Its IUPAC name is 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine |
| PubChem CID | 115112274 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1c(F)c(F)cc(-c2cnoc2N)c1F |
| InChI | InChI=1S/C10H7F3N2O2/c1-16-9-7(12)4(2-6(11)8(9)13)5-3-15-17-10(5)14/h2-3H,14H2,1H3 |
| InChIKey | DKHAPUABMFDNJS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine?
The IUPAC name of 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine (CID 115112274) is 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine.
What is the SMILES notation for 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine?
The canonical SMILES for 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine is COc1c(F)c(F)cc(-c2cnoc2N)c1F.
What is the InChIKey of 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine?
The InChIKey is DKHAPUABMFDNJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O2/c1-16-9-7(12)4(2-6(11)8(9)13)5-3-15-17-10(5)14/h2-3H,14H2,1H3.
What are the key properties of 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine?
4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine has a molecular weight of 244.17 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4,5-trifluoro-3-methoxyphenyl)-1,2-oxazol-5-amine is sourced from PubChem (CID 115112274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).