C25H40N4O3S — CID 11511267
N-[3-[4-[4-(cyclohexylmethylsulfonylamino)butyl]piperazin-1-yl]phenyl]cyclopropanecarboxamide (PubChem CID 11511267) has the molecular formula C25H40N4O3S and a molecular weight of 476.69 g/mol. Its IUPAC name is N-[3-[4-[4-(cyclohexylmethylsulfonylamino)butyl]piperazin-1-yl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[4-[4-(cyclohexylmethylsulfonylamino)butyl]piperazin-1-yl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 11511267 |
| Molecular Formula | C25H40N4O3S |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | N-[3-[4-[4-(cyclohexylmethylsulfonylamino)butyl]piperazin-1-yl]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1cccc(N2CCN(CCCCNS(=O)(=O)CC3CCCCC3)CC2)c1)C1CC1 |
| InChI | InChI=1S/C25H40N4O3S/c30-25(22-11-12-22)27-23-9-6-10-24(19-23)29-17-15-28(16-18-29)14-5-4-13-26-33(31,32)20-21-7-2-1-3-8-21/h6,9-10,19,21-22,26H,1-5,7-8,11-18,20H2,(H,27,30) |
| InChIKey | AKDDQOOXABRYDQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|