C9H6F3N3O2 — CID 115112789
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2,5,6-trifluorophenol (PubChem CID 115112789) has the molecular formula C9H6F3N3O2 and a molecular weight of 245.16 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2,5,6-trifluorophenol.
| Compound Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2,5,6-trifluorophenol |
|---|---|
| PubChem CID | 115112789 |
| Molecular Formula | C9H6F3N3O2 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]-2,5,6-trifluorophenol |
| SMILES | NCc1nc(-c2cc(F)c(F)c(O)c2F)no1 |
| InChI | InChI=1S/C9H6F3N3O2/c10-4-1-3(6(11)8(16)7(4)12)9-14-5(2-13)17-15-9/h1,16H,2,13H2 |
| InChIKey | QRDNMXRDHVADME-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|