C31H31N3O3 — CID 11511564
ethyl 2-[4-[2-(naphthalene-1-carbonylamino)-4-phenylphenyl]piperazin-1-yl]acetate (PubChem CID 11511564) has the molecular formula C31H31N3O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is ethyl 2-[4-[2-(naphthalene-1-carbonylamino)-4-phenylphenyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[2-(naphthalene-1-carbonylamino)-4-phenylphenyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 11511564 |
| Molecular Formula | C31H31N3O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | ethyl 2-[4-[2-(naphthalene-1-carbonylamino)-4-phenylphenyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(c2ccc(-c3ccccc3)cc2NC(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C31H31N3O3/c1-2-37-30(35)22-33-17-19-34(20-18-33)29-16-15-25(23-9-4-3-5-10-23)21-28(29)32-31(36)27-14-8-12-24-11-6-7-13-26(24)27/h3-16,21H,2,17-20,22H2,1H3,(H,32,36) |
| InChIKey | VELNTZUBONHZJA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |