C27H37N3O4S — CID 11511667
2-[[2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 11511667) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is 2-[[2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
| Compound Name | 2-[[2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 11511667 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 2-[[2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]phenyl]sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| SMILES | CN1C(C)(C)CC(Nc2ccccc2S(=O)(=O)Nc2ccc3c(c2C(=O)O)CCCC3)CC1(C)C |
| InChI | InChI=1S/C27H37N3O4S/c1-26(2)16-19(17-27(3,4)30(26)5)28-21-12-8-9-13-23(21)35(33,34)29-22-15-14-18-10-6-7-11-20(18)24(22)25(31)32/h8-9,12-15,19,28-29H,6-7,10-11,16-17H2,1-5H3,(H,31,32) |
| InChIKey | GRJIKPWOWUZNJG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |