C12H17FN2O — CID 115117101
1-N-(3-fluoro-4-methoxyphenyl)cyclopentane-1,2-diamine (PubChem CID 115117101) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-N-(3-fluoro-4-methoxyphenyl)cyclopentane-1,2-diamine.
| Compound Name | 1-N-(3-fluoro-4-methoxyphenyl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 115117101 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-N-(3-fluoro-4-methoxyphenyl)cyclopentane-1,2-diamine |
| SMILES | COc1ccc(NC2CCCC2N)cc1F |
| InChI | InChI=1S/C12H17FN2O/c1-16-12-6-5-8(7-9(12)13)15-11-4-2-3-10(11)14/h5-7,10-11,15H,2-4,14H2,1H3 |
| InChIKey | YPZXQJFYLXMAAK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|