C15H22N2O2 — CID 115117806
2-N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)cyclohexane-1,2-diamine (PubChem CID 115117806) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 115117806 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)cyclohexane-1,2-diamine |
| SMILES | Cc1cc2c(cc1NC1CCCCC1N)OCCO2 |
| InChI | InChI=1S/C15H22N2O2/c1-10-8-14-15(19-7-6-18-14)9-13(10)17-12-5-3-2-4-11(12)16/h8-9,11-12,17H,2-7,16H2,1H3 |
| InChIKey | JGUZXPYGSKPFMN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|