C13H19FN2O — CID 115118835
N-[(4-ethoxy-3-fluorophenyl)methyl]pyrrolidin-3-amine (PubChem CID 115118835) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is N-[(4-ethoxy-3-fluorophenyl)methyl]pyrrolidin-3-amine.
| Compound Name | N-[(4-ethoxy-3-fluorophenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115118835 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-[(4-ethoxy-3-fluorophenyl)methyl]pyrrolidin-3-amine |
| SMILES | CCOc1ccc(CNC2CCNC2)cc1F |
| InChI | InChI=1S/C13H19FN2O/c1-2-17-13-4-3-10(7-12(13)14)8-16-11-5-6-15-9-11/h3-4,7,11,15-16H,2,5-6,8-9H2,1H3 |
| InChIKey | KKLDMCVIVAECCK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |