C11H16N4O2 — CID 115119444
6-(2,3-diaminopropylamino)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 115119444) has the molecular formula C11H16N4O2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 6-(2,3-diaminopropylamino)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(2,3-diaminopropylamino)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115119444 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 6-(2,3-diaminopropylamino)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(NCC(N)CN)ccc21 |
| InChI | InChI=1S/C11H16N4O2/c1-15-9-3-2-8(14-6-7(13)5-12)4-10(9)17-11(15)16/h2-4,7,14H,5-6,12-13H2,1H3 |
| InChIKey | GVECAZAZXUIJDD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 99.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |