C13H23N3O — CID 115119699
3-N-[(4-ethoxy-3-methylphenyl)methyl]propane-1,2,3-triamine (PubChem CID 115119699) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-N-[(4-ethoxy-3-methylphenyl)methyl]propane-1,2,3-triamine.
| Compound Name | 3-N-[(4-ethoxy-3-methylphenyl)methyl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119699 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 3-N-[(4-ethoxy-3-methylphenyl)methyl]propane-1,2,3-triamine |
| SMILES | CCOc1ccc(CNCC(N)CN)cc1C |
| InChI | InChI=1S/C13H23N3O/c1-3-17-13-5-4-11(6-10(13)2)8-16-9-12(15)7-14/h4-6,12,16H,3,7-9,14-15H2,1-2H3 |
| InChIKey | HPVLZQYROFLGAZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|