About N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide
N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide (PubChem CID 11512086) has the molecular formula C31H29Cl2N3O
and a molecular weight of 530.50 g/mol. Its IUPAC name is N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide.
Molecular Properties
| Compound Name | N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide |
| PubChem CID | 11512086 |
| Molecular Formula | C31H29Cl2N3O |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C31H29Cl2N3O/c32-27-18-10-17-26(28(27)33)30(25-15-8-3-9-16-25)35-19-21-36(22-20-35)31(37)34-29(23-11-4-1-5-12-23)24-13-6-2-7-14-24/h1-18,29-30H,19-22H2,(H,34,37) |
| InChIKey | JJWWPFHYFYVBMO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide?
The IUPAC name of N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide (CID 11512086) is N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide.
What is the SMILES notation for N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide?
The canonical SMILES for N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide is O=C(NC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2cccc(Cl)c2Cl)CC1.
What is the InChIKey of N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide?
The InChIKey is JJWWPFHYFYVBMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H29Cl2N3O/c32-27-18-10-17-26(28(27)33)30(25-15-8-3-9-16-25)35-19-21-36(22-20-35)31(37)34-29(23-11-4-1-5-12-23)24-13-6-2-7-14-24/h1-18,29-30H,19-22H2,(H,34,37).
What are the key properties of N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide?
N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide has a molecular weight of 530.50 g/mol, XLogP of 7.20, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydryl-4-[(2,3-dichlorophenyl)-phenylmethyl]piperazine-1-carboxamide is sourced from PubChem (CID 11512086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).