C15H26N2O2 — CID 115121813
1-amino-3-[[2-(2-methoxy-5-methylphenyl)-2-methylpropyl]amino]propan-2-ol (PubChem CID 115121813) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-amino-3-[[2-(2-methoxy-5-methylphenyl)-2-methylpropyl]amino]propan-2-ol.
| Compound Name | 1-amino-3-[[2-(2-methoxy-5-methylphenyl)-2-methylpropyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 115121813 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1-amino-3-[[2-(2-methoxy-5-methylphenyl)-2-methylpropyl]amino]propan-2-ol |
| SMILES | COc1ccc(C)cc1C(C)(C)CNCC(O)CN |
| InChI | InChI=1S/C15H26N2O2/c1-11-5-6-14(19-4)13(7-11)15(2,3)10-17-9-12(18)8-16/h5-7,12,17-18H,8-10,16H2,1-4H3 |
| InChIKey | RIFRYJZRIXOZIN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |