C30H42N2O5S — CID 11512237
(1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 11512237) has the molecular formula C30H42N2O5S and a molecular weight of 542.74 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 11512237 |
| Molecular Formula | C30H42N2O5S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-7,11-dihydroxy-8,8,12,16-tetramethyl-3-(2-methyl-1,3-benzothiazol-5-yl)-10-prop-2-enyl-17-oxa-4-azabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C=CC[C@@H]1C(=O)C(C)(C)[C@@H](O)CC(=O)N[C@H](c2ccc3sc(C)nc3c2)C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H42N2O5S/c1-7-9-20-27(35)17(2)10-8-13-30(6)25(37-30)15-21(19-11-12-23-22(14-19)31-18(3)38-23)32-26(34)16-24(33)29(4,5)28(20)36/h7,11-12,14,17,20-21,24-25,27,33,35H,1,8-10,13,15-16H2,2-6H3,(H,32,34)/t17-,20-,21-,24-,25-,27-,30+/m0/s1 |
| InChIKey | HVYDFLLSZAVXPY-BQAJEERZSA-N |
| XLogP | 5.03 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|