C26H26ClN3O6S — CID 11512252
[5-amino-1-(chloromethyl)-7-methylsulfonyl-1,2-dihydrobenzo[e]indol-3-yl]-(5,6,7-trimethoxy-1H-indol-2-yl)methanone (PubChem CID 11512252) has the molecular formula C26H26ClN3O6S and a molecular weight of 544.03 g/mol. Its IUPAC name is [5-amino-1-(chloromethyl)-7-methylsulfonyl-1,2-dihydrobenzo[e]indol-3-yl]-(5,6,7-trimethoxy-1H-indol-2-yl)methanone.
| Compound Name | [5-amino-1-(chloromethyl)-7-methylsulfonyl-1,2-dihydrobenzo[e]indol-3-yl]-(5,6,7-trimethoxy-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 11512252 |
| Molecular Formula | C26H26ClN3O6S |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | [5-amino-1-(chloromethyl)-7-methylsulfonyl-1,2-dihydrobenzo[e]indol-3-yl]-(5,6,7-trimethoxy-1H-indol-2-yl)methanone |
| SMILES | COc1cc2cc(C(=O)N3CC(CCl)c4c3cc(N)c3cc(S(C)(=O)=O)ccc43)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C26H26ClN3O6S/c1-34-21-8-13-7-19(29-23(13)25(36-3)24(21)35-2)26(31)30-12-14(11-27)22-16-6-5-15(37(4,32)33)9-17(16)18(28)10-20(22)30/h5-10,14,29H,11-12,28H2,1-4H3 |
| InChIKey | JNEFRXUIQUVTEG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|