C27H27N7O4S — CID 11512264
1-[4-(13,13-dioxo-13λ6-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)phenyl]-3-(4-methoxyphenyl)urea (PubChem CID 11512264) has the molecular formula C27H27N7O4S and a molecular weight of 545.63 g/mol. Its IUPAC name is 1-[4-(13,13-dioxo-13λ6-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)phenyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[4-(13,13-dioxo-13λ6-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)phenyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 11512264 |
| Molecular Formula | C27H27N7O4S |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 1-[4-(13,13-dioxo-13λ6-thia-2,4,8,12,19-pentazatricyclo[12.3.1.13,7]nonadeca-1(18),3,5,7(19),14,16-hexaen-6-yl)phenyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(-c3cnc4nc3NCCCNS(=O)(=O)c3cccc(c3)N4)cc2)cc1 |
| InChI | InChI=1S/C27H27N7O4S/c1-38-22-12-10-20(11-13-22)33-27(35)32-19-8-6-18(7-9-19)24-17-29-26-31-21-4-2-5-23(16-21)39(36,37)30-15-3-14-28-25(24)34-26/h2,4-13,16-17,30H,3,14-15H2,1H3,(H2,32,33,35)(H2,28,29,31,34) |
| InChIKey | CRRNHYVWJDKZBA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |