C14H20BrNO3 — CID 115122814
5-[2-(3-bromophenyl)ethyl-methylamino]-4-hydroxypentanoic acid (PubChem CID 115122814) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is 5-[2-(3-bromophenyl)ethyl-methylamino]-4-hydroxypentanoic acid.
| Compound Name | 5-[2-(3-bromophenyl)ethyl-methylamino]-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 115122814 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 5-[2-(3-bromophenyl)ethyl-methylamino]-4-hydroxypentanoic acid |
| SMILES | CN(CCc1cccc(Br)c1)CC(O)CCC(=O)O |
| InChI | InChI=1S/C14H20BrNO3/c1-16(10-13(17)5-6-14(18)19)8-7-11-3-2-4-12(15)9-11/h2-4,9,13,17H,5-8,10H2,1H3,(H,18,19) |
| InChIKey | WWFWCWKCVCGPRT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |