C11H14BrNO3 — CID 115122991
4-(2-bromo-N-methylanilino)-3-hydroxybutanoic acid (PubChem CID 115122991) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is 4-(2-bromo-N-methylanilino)-3-hydroxybutanoic acid.
| Compound Name | 4-(2-bromo-N-methylanilino)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 115122991 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-(2-bromo-N-methylanilino)-3-hydroxybutanoic acid |
| SMILES | CN(CC(O)CC(=O)O)c1ccccc1Br |
| InChI | InChI=1S/C11H14BrNO3/c1-13(7-8(14)6-11(15)16)10-5-3-2-4-9(10)12/h2-5,8,14H,6-7H2,1H3,(H,15,16) |
| InChIKey | KMIBSYHIHWTUDL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |