About methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate
methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate (PubChem CID 115123454) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate.
Analyze methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate?
The IUPAC name of methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate (CID 115123454) is methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate.
What is the SMILES notation for methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate?
The canonical SMILES for methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate is COC(=O)CC(O)CN(C)CCC(C)(C)C.
What is the InChIKey of methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate?
The InChIKey is IWUBQUVGGZNSHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-12(2,3)6-7-13(4)9-10(14)8-11(15)16-5/h10,14H,6-9H2,1-5H3.
What are the key properties of methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate?
methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate has a molecular weight of 231.34 g/mol, XLogP of 1.28, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3,3-dimethylbutyl(methyl)amino]-3-hydroxybutanoate is sourced from PubChem (CID 115123454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).