C14H20FNO3 — CID 115123467
methyl 4-[2-(3-fluorophenyl)ethyl-methylamino]-3-hydroxybutanoate (PubChem CID 115123467) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is methyl 4-[2-(3-fluorophenyl)ethyl-methylamino]-3-hydroxybutanoate.
| Compound Name | methyl 4-[2-(3-fluorophenyl)ethyl-methylamino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 115123467 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl 4-[2-(3-fluorophenyl)ethyl-methylamino]-3-hydroxybutanoate |
| SMILES | COC(=O)CC(O)CN(C)CCc1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNO3/c1-16(10-13(17)9-14(18)19-2)7-6-11-4-3-5-12(15)8-11/h3-5,8,13,17H,6-7,9-10H2,1-2H3 |
| InChIKey | CLUCRFMNVLDUHC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |