C26H18Cl3FN2O5 — CID 11512461
2-[3-chloro-4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-(4-fluorophenyl)-1,2-oxazol-3-yl]phenyl]acetic acid (PubChem CID 11512461) has the molecular formula C26H18Cl3FN2O5 and a molecular weight of 563.80 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-(4-fluorophenyl)-1,2-oxazol-3-yl]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-(4-fluorophenyl)-1,2-oxazol-3-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 11512461 |
| Molecular Formula | C26H18Cl3FN2O5 |
| Molecular Weight | 563.80 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | 2-[3-chloro-4-[4-[2-(2,4-dichlorophenoxy)ethylcarbamoyl]-5-(4-fluorophenyl)-1,2-oxazol-3-yl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2noc(-c3ccc(F)cc3)c2C(=O)NCCOc2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H18Cl3FN2O5/c27-16-4-8-21(20(29)13-16)36-10-9-31-26(35)23-24(18-7-1-14(11-19(18)28)12-22(33)34)32-37-25(23)15-2-5-17(30)6-3-15/h1-8,11,13H,9-10,12H2,(H,31,35)(H,33,34) |
| InChIKey | XJMBJPHDKOWSEK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.80 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|