C37H34N2O4 — CID 11512525
(3aR,6R,7aR)-N,1'-dibenzyl-2,2-dimethyl-2'-oxo-N-phenylspiro[7,7a-dihydro-3aH-1,3-benzodioxole-6,3'-indole]-5-carboxamide (PubChem CID 11512525) has the molecular formula C37H34N2O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is (3aR,6R,7aR)-N,1'-dibenzyl-2,2-dimethyl-2'-oxo-N-phenylspiro[7,7a-dihydro-3aH-1,3-benzodioxole-6,3'-indole]-5-carboxamide.
| Compound Name | (3aR,6R,7aR)-N,1'-dibenzyl-2,2-dimethyl-2'-oxo-N-phenylspiro[7,7a-dihydro-3aH-1,3-benzodioxole-6,3'-indole]-5-carboxamide |
|---|---|
| PubChem CID | 11512525 |
| Molecular Formula | C37H34N2O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | (3aR,6R,7aR)-N,1'-dibenzyl-2,2-dimethyl-2'-oxo-N-phenylspiro[7,7a-dihydro-3aH-1,3-benzodioxole-6,3'-indole]-5-carboxamide |
| SMILES | CC1(C)O[C@@H]2C=C(C(=O)N(Cc3ccccc3)c3ccccc3)[C@]3(C[C@H]2O1)C(=O)N(Cc1ccccc1)c1ccccc13 |
| InChI | InChI=1S/C37H34N2O4/c1-36(2)42-32-22-30(34(40)38(28-18-10-5-11-19-28)24-26-14-6-3-7-15-26)37(23-33(32)43-36)29-20-12-13-21-31(29)39(35(37)41)25-27-16-8-4-9-17-27/h3-22,32-33H,23-25H2,1-2H3/t32-,33-,37-/m1/s1 |
| InChIKey | RQWDREUQLHJXOU-XXUJLVSLSA-N |
| XLogP | 6.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |