C35H38O6S — CID 11512651
2-[[(2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]ethanol (PubChem CID 11512651) has the molecular formula C35H38O6S and a molecular weight of 586.75 g/mol. Its IUPAC name is 2-[[(2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]ethanol.
| Compound Name | 2-[[(2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]ethanol |
|---|---|
| PubChem CID | 11512651 |
| Molecular Formula | C35H38O6S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 2-[[(2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methoxy]ethanol |
| SMILES | OCCOC[C@H]1O[C@@H](Sc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H38O6S/c36-21-22-37-26-31-32(38-23-27-13-5-1-6-14-27)33(39-24-28-15-7-2-8-16-28)34(40-25-29-17-9-3-10-18-29)35(41-31)42-30-19-11-4-12-20-30/h1-20,31-36H,21-26H2/t31-,32+,33+,34-,35+/m1/s1 |
| InChIKey | URJBRHPYVUIMMS-NVCPMKERSA-N |
| XLogP | 6.27 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|