C14H22N2 — CID 115126836
2-N-(2-cyclobutylethyl)-4,5-dimethylbenzene-1,2-diamine (PubChem CID 115126836) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-N-(2-cyclobutylethyl)-4,5-dimethylbenzene-1,2-diamine.
| Compound Name | 2-N-(2-cyclobutylethyl)-4,5-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 115126836 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-N-(2-cyclobutylethyl)-4,5-dimethylbenzene-1,2-diamine |
| SMILES | Cc1cc(N)c(NCCC2CCC2)cc1C |
| InChI | InChI=1S/C14H22N2/c1-10-8-13(15)14(9-11(10)2)16-7-6-12-4-3-5-12/h8-9,12,16H,3-7,15H2,1-2H3 |
| InChIKey | BPKGSINVMQXQKT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|