C25H21BrF2N3O5P — CID 11512692
[[4-[[3-benzyl-5-(4-carbamoylphenyl)-2-oxoimidazol-1-yl]methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid (PubChem CID 11512692) has the molecular formula C25H21BrF2N3O5P and a molecular weight of 592.33 g/mol. Its IUPAC name is [[4-[[3-benzyl-5-(4-carbamoylphenyl)-2-oxoimidazol-1-yl]methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[[3-benzyl-5-(4-carbamoylphenyl)-2-oxoimidazol-1-yl]methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 11512692 |
| Molecular Formula | C25H21BrF2N3O5P |
| Molecular Weight | 592.33 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | [[4-[[3-benzyl-5-(4-carbamoylphenyl)-2-oxoimidazol-1-yl]methyl]-2-bromophenyl]-difluoromethyl]phosphonic acid |
| SMILES | NC(=O)c1ccc(-c2cn(Cc3ccccc3)c(=O)n2Cc2ccc(C(F)(F)P(=O)(O)O)c(Br)c2)cc1 |
| InChI | InChI=1S/C25H21BrF2N3O5P/c26-21-12-17(6-11-20(21)25(27,28)37(34,35)36)14-31-22(18-7-9-19(10-8-18)23(29)32)15-30(24(31)33)13-16-4-2-1-3-5-16/h1-12,15H,13-14H2,(H2,29,32)(H2,34,35,36) |
| InChIKey | ZVWKONYLWANCGO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 127.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|