C14H14BrFN2O — CID 115127077
1-N-[(3-bromo-4-methoxyphenyl)methyl]-3-fluorobenzene-1,2-diamine (PubChem CID 115127077) has the molecular formula C14H14BrFN2O and a molecular weight of 325.18 g/mol. Its IUPAC name is 1-N-[(3-bromo-4-methoxyphenyl)methyl]-3-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-[(3-bromo-4-methoxyphenyl)methyl]-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 115127077 |
| Molecular Formula | C14H14BrFN2O |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 1-N-[(3-bromo-4-methoxyphenyl)methyl]-3-fluorobenzene-1,2-diamine |
| SMILES | COc1ccc(CNc2cccc(F)c2N)cc1Br |
| InChI | InChI=1S/C14H14BrFN2O/c1-19-13-6-5-9(7-10(13)15)8-18-12-4-2-3-11(16)14(12)17/h2-7,18H,8,17H2,1H3 |
| InChIKey | LEZWICYLWDLUKP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|