C15H24FN3 — CID 115127159
3-fluoro-1-N-methyl-1-N-[2-(1-methylpiperidin-3-yl)ethyl]benzene-1,2-diamine (PubChem CID 115127159) has the molecular formula C15H24FN3 and a molecular weight of 265.38 g/mol. Its IUPAC name is 3-fluoro-1-N-methyl-1-N-[2-(1-methylpiperidin-3-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-methyl-1-N-[2-(1-methylpiperidin-3-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115127159 |
| Molecular Formula | C15H24FN3 |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 3-fluoro-1-N-methyl-1-N-[2-(1-methylpiperidin-3-yl)ethyl]benzene-1,2-diamine |
| SMILES | CN1CCCC(CCN(C)c2cccc(F)c2N)C1 |
| InChI | InChI=1S/C15H24FN3/c1-18-9-4-5-12(11-18)8-10-19(2)14-7-3-6-13(16)15(14)17/h3,6-7,12H,4-5,8-11,17H2,1-2H3 |
| InChIKey | UXEYSWSYEPVKDB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|