C15H21N3 — CID 115127341
4-amino-3-[2-cyclopentylethyl(methyl)amino]benzonitrile (PubChem CID 115127341) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-amino-3-[2-cyclopentylethyl(methyl)amino]benzonitrile.
| Compound Name | 4-amino-3-[2-cyclopentylethyl(methyl)amino]benzonitrile |
|---|---|
| PubChem CID | 115127341 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-amino-3-[2-cyclopentylethyl(methyl)amino]benzonitrile |
| SMILES | CN(CCC1CCCC1)c1cc(C#N)ccc1N |
| InChI | InChI=1S/C15H21N3/c1-18(9-8-12-4-2-3-5-12)15-10-13(11-16)6-7-14(15)17/h6-7,10,12H,2-5,8-9,17H2,1H3 |
| InChIKey | HTFRWSUSKNJSQE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|