C15H15BrN2O2 — CID 115127622
3-amino-4-[(5-bromo-2-methylphenyl)methylamino]benzoic acid (PubChem CID 115127622) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 3-amino-4-[(5-bromo-2-methylphenyl)methylamino]benzoic acid.
| Compound Name | 3-amino-4-[(5-bromo-2-methylphenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 115127622 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-amino-4-[(5-bromo-2-methylphenyl)methylamino]benzoic acid |
| SMILES | Cc1ccc(Br)cc1CNc1ccc(C(=O)O)cc1N |
| InChI | InChI=1S/C15H15BrN2O2/c1-9-2-4-12(16)6-11(9)8-18-14-5-3-10(15(19)20)7-13(14)17/h2-7,18H,8,17H2,1H3,(H,19,20) |
| InChIKey | UBMDRRLVRSACLA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|