C34H40N10O — CID 11512769
4-[5-[4-(4-benzylpiperazin-1-yl)anilino]triazolo[4,5-d]pyrimidin-3-yl]-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 11512769) has the molecular formula C34H40N10O and a molecular weight of 604.76 g/mol. Its IUPAC name is 4-[5-[4-(4-benzylpiperazin-1-yl)anilino]triazolo[4,5-d]pyrimidin-3-yl]-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-[5-[4-(4-benzylpiperazin-1-yl)anilino]triazolo[4,5-d]pyrimidin-3-yl]-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 11512769 |
| Molecular Formula | C34H40N10O |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | 4-[5-[4-(4-benzylpiperazin-1-yl)anilino]triazolo[4,5-d]pyrimidin-3-yl]-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(-n2nnc3cnc(Nc4ccc(N5CCN(Cc6ccccc6)CC5)cc4)nc32)cc1 |
| InChI | InChI=1S/C34H40N10O/c1-3-41(4-2)19-18-35-33(45)27-10-14-30(15-11-27)44-32-31(39-40-44)24-36-34(38-32)37-28-12-16-29(17-13-28)43-22-20-42(21-23-43)25-26-8-6-5-7-9-26/h5-17,24H,3-4,18-23,25H2,1-2H3,(H,35,45)(H,36,37,38) |
| InChIKey | NRNHAQACPDEDPQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|